C10H16F6N2S — CID 103778077
1-(2,2,2-trifluoroethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine (PubChem CID 103778077) has the molecular formula C10H16F6N2S and a molecular weight of 310.31 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine.
| Compound Name | 1-(2,2,2-trifluoroethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 103778077 |
| Molecular Formula | C10H16F6N2S |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-amine |
| SMILES | FC(F)(F)CN1CCC(NCCSC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16F6N2S/c11-9(12,13)7-18-4-1-8(2-5-18)17-3-6-19-10(14,15)16/h8,17H,1-7H2 |
| InChIKey | PLCDJPQRUFNFDU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|