C12H23F3N2S — CID 170623102
1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine (PubChem CID 170623102) has the molecular formula C12H23F3N2S and a molecular weight of 284.39 g/mol. Its IUPAC name is 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine.
| Compound Name | 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 170623102 |
| Molecular Formula | C12H23F3N2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine |
| SMILES | CCCCSN1CCC(NCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H23F3N2S/c1-2-3-10-18-17-8-4-11(5-9-17)16-7-6-12(13,14)15/h11,16H,2-10H2,1H3 |
| InChIKey | PTNBJGDFAWOJSA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|