About 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine
1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine (PubChem CID 170623102) has the molecular formula C12H23F3N2S
and a molecular weight of 284.39 g/mol. Its IUPAC name is 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine |
| PubChem CID | 170623102 |
| Molecular Formula | C12H23F3N2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine |
| SMILES | CCCCSN1CCC(NCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H23F3N2S/c1-2-3-10-18-17-8-4-11(5-9-17)16-7-6-12(13,14)15/h11,16H,2-10H2,1H3 |
| InChIKey | PTNBJGDFAWOJSA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine?
The IUPAC name of 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine (CID 170623102) is 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine.
What is the SMILES notation for 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine?
The canonical SMILES for 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine is CCCCSN1CCC(NCCC(F)(F)F)CC1.
What is the InChIKey of 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine?
The InChIKey is PTNBJGDFAWOJSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F3N2S/c1-2-3-10-18-17-8-4-11(5-9-17)16-7-6-12(13,14)15/h11,16H,2-10H2,1H3.
What are the key properties of 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine?
1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine has a molecular weight of 284.39 g/mol, XLogP of 3.44, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylsulfanyl-N-(3,3,3-trifluoropropyl)piperidin-4-amine is sourced from PubChem (CID 170623102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).