C23H23N3O2S — CID 1035334
N-[(6-methoxy-8-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-quinolin-8-ylsulfanylacetamide (PubChem CID 1035334) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[(6-methoxy-8-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-quinolin-8-ylsulfanylacetamide.
| Compound Name | N-[(6-methoxy-8-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-quinolin-8-ylsulfanylacetamide |
|---|---|
| PubChem CID | 1035334 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[(6-methoxy-8-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2-quinolin-8-ylsulfanylacetamide |
| SMILES | COc1cc(C)c2c(c1)CCCC2=NNC(=O)CSc1cccc2cccnc12 |
| InChI | InChI=1S/C23H23N3O2S/c1-15-12-18(28-2)13-17-7-3-9-19(22(15)17)25-26-21(27)14-29-20-10-4-6-16-8-5-11-24-23(16)20/h4-6,8,10-13H,3,7,9,14H2,1-2H3,(H,26,27) |
| InChIKey | ZCMXSNJUJDZTLZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|