C12H24N2O2 — CID 103533927
4-[(3,4-dimethoxypyrrolidin-1-yl)methyl]piperidine (PubChem CID 103533927) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-[(3,4-dimethoxypyrrolidin-1-yl)methyl]piperidine.
| Compound Name | 4-[(3,4-dimethoxypyrrolidin-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 103533927 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 4-[(3,4-dimethoxypyrrolidin-1-yl)methyl]piperidine |
| SMILES | COC1CN(CC2CCNCC2)CC1OC |
| InChI | InChI=1S/C12H24N2O2/c1-15-11-8-14(9-12(11)16-2)7-10-3-5-13-6-4-10/h10-13H,3-9H2,1-2H3 |
| InChIKey | QZCVMZJKKWAEHU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |