C10H21FO2Si — CID 10353428
methyl (2S,3S)-3-[fluoro(dimethyl)silyl]-2,4-dimethylpentanoate (PubChem CID 10353428) has the molecular formula C10H21FO2Si and a molecular weight of 220.36 g/mol. Its IUPAC name is methyl (2S,3S)-3-[fluoro(dimethyl)silyl]-2,4-dimethylpentanoate.
| Compound Name | methyl (2S,3S)-3-[fluoro(dimethyl)silyl]-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 10353428 |
| Molecular Formula | C10H21FO2Si |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | methyl (2S,3S)-3-[fluoro(dimethyl)silyl]-2,4-dimethylpentanoate |
| SMILES | COC(=O)[C@H](C)C(C(C)C)[Si](C)(C)F |
| InChI | InChI=1S/C10H21FO2Si/c1-7(2)9(14(5,6)11)8(3)10(12)13-4/h7-9H,1-6H3/t8-,9?/m1/s1 |
| InChIKey | CRATVAPSMHEKDY-VEDVMXKPSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|