C11H21F3O2Si — CID 91694224
[dimethyl(3,3,3-trifluoropropyl)silyl] 4-methylpentanoate (PubChem CID 91694224) has the molecular formula C11H21F3O2Si and a molecular weight of 270.37 g/mol. Its IUPAC name is [dimethyl(3,3,3-trifluoropropyl)silyl] 4-methylpentanoate.
| Compound Name | [dimethyl(3,3,3-trifluoropropyl)silyl] 4-methylpentanoate |
|---|---|
| PubChem CID | 91694224 |
| Molecular Formula | C11H21F3O2Si |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [dimethyl(3,3,3-trifluoropropyl)silyl] 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)O[Si](C)(C)CCC(F)(F)F |
| InChI | InChI=1S/C11H21F3O2Si/c1-9(2)5-6-10(15)16-17(3,4)8-7-11(12,13)14/h9H,5-8H2,1-4H3 |
| InChIKey | RBFURHYLXWARKM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|