C9H10F10O2Si — CID 91697410
trimethylsilyl 3,3,4,4,5,5,5-heptafluoro-2-(trifluoromethyl)pentanoate (PubChem CID 91697410) has the molecular formula C9H10F10O2Si and a molecular weight of 368.24 g/mol. Its IUPAC name is trimethylsilyl 3,3,4,4,5,5,5-heptafluoro-2-(trifluoromethyl)pentanoate.
| Compound Name | trimethylsilyl 3,3,4,4,5,5,5-heptafluoro-2-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 91697410 |
| Molecular Formula | C9H10F10O2Si |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | trimethylsilyl 3,3,4,4,5,5,5-heptafluoro-2-(trifluoromethyl)pentanoate |
| SMILES | C[Si](C)(C)OC(=O)C(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F10O2Si/c1-22(2,3)21-5(20)4(7(12,13)14)6(10,11)8(15,16)9(17,18)19/h4H,1-3H3 |
| InChIKey | IZDOQWCGLJKJPT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|