About trimethylsilyl 4-methylpentanoate
trimethylsilyl 4-methylpentanoate (PubChem CID 554430) has the molecular formula C9H20O2Si
and a molecular weight of 188.34 g/mol. Its IUPAC name is trimethylsilyl 4-methylpentanoate.
Molecular Properties
| Compound Name | trimethylsilyl 4-methylpentanoate |
| PubChem CID | 554430 |
| Molecular Formula | C9H20O2Si |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | trimethylsilyl 4-methylpentanoate |
| SMILES | CC(C)CCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C9H20O2Si/c1-8(2)6-7-9(10)11-12(3,4)5/h8H,6-7H2,1-5H3 |
| InChIKey | UMRHTNKGONZNDQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 4-methylpentanoate?
The IUPAC name of trimethylsilyl 4-methylpentanoate (CID 554430) is trimethylsilyl 4-methylpentanoate.
What is the SMILES notation for trimethylsilyl 4-methylpentanoate?
The canonical SMILES for trimethylsilyl 4-methylpentanoate is CC(C)CCC(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 4-methylpentanoate?
The InChIKey is UMRHTNKGONZNDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2Si/c1-8(2)6-7-9(10)11-12(3,4)5/h8H,6-7H2,1-5H3.
What are the key properties of trimethylsilyl 4-methylpentanoate?
trimethylsilyl 4-methylpentanoate has a molecular weight of 188.34 g/mol, XLogP of 2.80, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 4-methylpentanoate is sourced from PubChem (CID 554430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).