C15H21N3O3 — CID 103534541
6-(3,4-dimethoxypyrrolidin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one (PubChem CID 103534541) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 6-(3,4-dimethoxypyrrolidin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one.
| Compound Name | 6-(3,4-dimethoxypyrrolidin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 103534541 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 6-(3,4-dimethoxypyrrolidin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2cc(N3CC(OC)C(OC)C3)ccc21 |
| InChI | InChI=1S/C15H21N3O3/c1-16-14-10-5-4-9(6-11(10)17-15(14)19)18-7-12(20-2)13(8-18)21-3/h4-6,12-14,16H,7-8H2,1-3H3,(H,17,19) |
| InChIKey | JONKOQJQBWRILF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|