C13H17N3O3S — CID 43586866
6-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(methylamino)-1,3-dihydroindol-2-one (PubChem CID 43586866) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 6-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(methylamino)-1,3-dihydroindol-2-one.
| Compound Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(methylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43586866 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-3-(methylamino)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2cc(N3CCS(=O)(=O)CC3)ccc21 |
| InChI | InChI=1S/C13H17N3O3S/c1-14-12-10-3-2-9(8-11(10)15-13(12)17)16-4-6-20(18,19)7-5-16/h2-3,8,12,14H,4-7H2,1H3,(H,15,17) |
| InChIKey | BLMVUXKXCPEOSJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|