C10H19N3O2 — CID 103534609
N'-cyclopropyl-3,4-dimethoxypyrrolidine-1-carboximidamide (PubChem CID 103534609) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is N'-cyclopropyl-3,4-dimethoxypyrrolidine-1-carboximidamide.
| Compound Name | N'-cyclopropyl-3,4-dimethoxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 103534609 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N'-cyclopropyl-3,4-dimethoxypyrrolidine-1-carboximidamide |
| SMILES | COC1CN(/C(N)=N/C2CC2)CC1OC |
| InChI | InChI=1S/C10H19N3O2/c1-14-8-5-13(6-9(8)15-2)10(11)12-7-3-4-7/h7-9H,3-6H2,1-2H3,(H2,11,12) |
| InChIKey | MZBQXSRSQYDGSG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|