C9H19N3O2 — CID 103534612
N'-ethyl-3,4-dimethoxypyrrolidine-1-carboximidamide (PubChem CID 103534612) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is N'-ethyl-3,4-dimethoxypyrrolidine-1-carboximidamide.
| Compound Name | N'-ethyl-3,4-dimethoxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 103534612 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N'-ethyl-3,4-dimethoxypyrrolidine-1-carboximidamide |
| SMILES | CC/N=C(\N)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C9H19N3O2/c1-4-11-9(10)12-5-7(13-2)8(6-12)14-3/h7-8H,4-6H2,1-3H3,(H2,10,11) |
| InChIKey | RYVUHKFKSGJJJC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|