C10H21N3O2 — CID 103534613
3,4-dimethoxy-N'-propan-2-ylpyrrolidine-1-carboximidamide (PubChem CID 103534613) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-propan-2-ylpyrrolidine-1-carboximidamide.
| Compound Name | 3,4-dimethoxy-N'-propan-2-ylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 103534613 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 3,4-dimethoxy-N'-propan-2-ylpyrrolidine-1-carboximidamide |
| SMILES | COC1CN(/C(N)=N/C(C)C)CC1OC |
| InChI | InChI=1S/C10H21N3O2/c1-7(2)12-10(11)13-5-8(14-3)9(6-13)15-4/h7-9H,5-6H2,1-4H3,(H2,11,12) |
| InChIKey | UMKUMCCDIAVTME-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|