C14H20ClNO3 — CID 103535445
1-[2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)phenyl]ethanol (PubChem CID 103535445) has the molecular formula C14H20ClNO3 and a molecular weight of 285.77 g/mol. Its IUPAC name is 1-[2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)phenyl]ethanol.
| Compound Name | 1-[2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 103535445 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-[2-chloro-4-(3,4-dimethoxypyrrolidin-1-yl)phenyl]ethanol |
| SMILES | COC1CN(c2ccc(C(C)O)c(Cl)c2)CC1OC |
| InChI | InChI=1S/C14H20ClNO3/c1-9(17)11-5-4-10(6-12(11)15)16-7-13(18-2)14(8-16)19-3/h4-6,9,13-14,17H,7-8H2,1-3H3 |
| InChIKey | YWMFOOIZVSUUSU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|