C13H19BFNO4 — CID 103537531
[5-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2-fluorophenyl]boronic acid (PubChem CID 103537531) has the molecular formula C13H19BFNO4 and a molecular weight of 283.11 g/mol. Its IUPAC name is [5-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2-fluorophenyl]boronic acid.
| Compound Name | [5-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 103537531 |
| Molecular Formula | C13H19BFNO4 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | [5-[(3,4-dimethoxypyrrolidin-1-yl)methyl]-2-fluorophenyl]boronic acid |
| SMILES | COC1CN(Cc2ccc(F)c(B(O)O)c2)CC1OC |
| InChI | InChI=1S/C13H19BFNO4/c1-19-12-7-16(8-13(12)20-2)6-9-3-4-11(15)10(5-9)14(17)18/h3-5,12-13,17-18H,6-8H2,1-2H3 |
| InChIKey | CIGMANAVTUPNEF-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|