C13H19BFNO2 — CID 54970710
[2-fluoro-5-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid (PubChem CID 54970710) has the molecular formula C13H19BFNO2 and a molecular weight of 251.11 g/mol. Its IUPAC name is [2-fluoro-5-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid.
| Compound Name | [2-fluoro-5-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 54970710 |
| Molecular Formula | C13H19BFNO2 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [2-fluoro-5-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid |
| SMILES | CC1CCN(Cc2ccc(F)c(B(O)O)c2)CC1 |
| InChI | InChI=1S/C13H19BFNO2/c1-10-4-6-16(7-5-10)9-11-2-3-13(15)12(8-11)14(17)18/h2-3,8,10,17-18H,4-7,9H2,1H3 |
| InChIKey | JTESREBRRCXLMD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|