C13H26N4O2 — CID 103542275
N-amino-N'-cyclohexyl-3,4-dimethoxypyrrolidine-1-carboximidamide (PubChem CID 103542275) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-amino-N'-cyclohexyl-3,4-dimethoxypyrrolidine-1-carboximidamide.
| Compound Name | N-amino-N'-cyclohexyl-3,4-dimethoxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 103542275 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-amino-N'-cyclohexyl-3,4-dimethoxypyrrolidine-1-carboximidamide |
| SMILES | COC1CN(/C(=N/C2CCCCC2)NN)CC1OC |
| InChI | InChI=1S/C13H26N4O2/c1-18-11-8-17(9-12(11)19-2)13(16-14)15-10-6-4-3-5-7-10/h10-12H,3-9,14H2,1-2H3,(H,15,16) |
| InChIKey | FCTUBFMEWNFGRM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|