C11H24N4O3 — CID 103542276
N-amino-3,4-dimethoxy-N'-(3-methoxypropyl)pyrrolidine-1-carboximidamide (PubChem CID 103542276) has the molecular formula C11H24N4O3 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-amino-3,4-dimethoxy-N'-(3-methoxypropyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-amino-3,4-dimethoxy-N'-(3-methoxypropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 103542276 |
| Molecular Formula | C11H24N4O3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | N-amino-3,4-dimethoxy-N'-(3-methoxypropyl)pyrrolidine-1-carboximidamide |
| SMILES | COCCC/N=C(\NN)N1CC(OC)C(OC)C1 |
| InChI | InChI=1S/C11H24N4O3/c1-16-6-4-5-13-11(14-12)15-7-9(17-2)10(8-15)18-3/h9-10H,4-8,12H2,1-3H3,(H,13,14) |
| InChIKey | DKPPBNFBQDKYHW-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|