C7H16N4O2 — CID 103534614
N'-amino-3,4-dimethoxypyrrolidine-1-carboximidamide (PubChem CID 103534614) has the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is N'-amino-3,4-dimethoxypyrrolidine-1-carboximidamide.
| Compound Name | N'-amino-3,4-dimethoxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 103534614 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N'-amino-3,4-dimethoxypyrrolidine-1-carboximidamide |
| SMILES | COC1CN(C(N)=NN)CC1OC |
| InChI | InChI=1S/C7H16N4O2/c1-12-5-3-11(7(8)10-9)4-6(5)13-2/h5-6H,3-4,9H2,1-2H3,(H2,8,10) |
| InChIKey | MNAUNWVCJIBZQM-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|