C10H19NO2 — CID 103546903
1-(1,3-dioxolan-2-yl)-N-propylbut-3-en-2-amine (PubChem CID 103546903) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-N-propylbut-3-en-2-amine.
| Compound Name | 1-(1,3-dioxolan-2-yl)-N-propylbut-3-en-2-amine |
|---|---|
| PubChem CID | 103546903 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-N-propylbut-3-en-2-amine |
| SMILES | C=CC(CC1OCCO1)NCCC |
| InChI | InChI=1S/C10H19NO2/c1-3-5-11-9(4-2)8-10-12-6-7-13-10/h4,9-11H,2-3,5-8H2,1H3 |
| InChIKey | QYRZFRFWPDVVLX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|