C11H23NO3 — CID 103546950
1-(1,3-dioxolan-2-yl)-3-ethoxy-N-propylpropan-2-amine (PubChem CID 103546950) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-3-ethoxy-N-propylpropan-2-amine.
| Compound Name | 1-(1,3-dioxolan-2-yl)-3-ethoxy-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 103546950 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-3-ethoxy-N-propylpropan-2-amine |
| SMILES | CCCNC(COCC)CC1OCCO1 |
| InChI | InChI=1S/C11H23NO3/c1-3-5-12-10(9-13-4-2)8-11-14-6-7-15-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | LCNMBPXAMPYNJB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |