C13H27NO2 — CID 103546990
1-(1,3-dioxolan-2-yl)-3-ethyl-N-propylpentan-2-amine (PubChem CID 103546990) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-3-ethyl-N-propylpentan-2-amine.
| Compound Name | 1-(1,3-dioxolan-2-yl)-3-ethyl-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 103546990 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-3-ethyl-N-propylpentan-2-amine |
| SMILES | CCCNC(CC1OCCO1)C(CC)CC |
| InChI | InChI=1S/C13H27NO2/c1-4-7-14-12(11(5-2)6-3)10-13-15-8-9-16-13/h11-14H,4-10H2,1-3H3 |
| InChIKey | PCEABGCUDSDMFO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |