C9H18N2O3S — CID 103549584
2-(morpholin-3-ylmethyl)thiazinane 1,1-dioxide (PubChem CID 103549584) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-(morpholin-3-ylmethyl)thiazinane 1,1-dioxide.
| Compound Name | 2-(morpholin-3-ylmethyl)thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 103549584 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-(morpholin-3-ylmethyl)thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1CC1COCCN1 |
| InChI | InChI=1S/C9H18N2O3S/c12-15(13)6-2-1-4-11(15)7-9-8-14-5-3-10-9/h9-10H,1-8H2 |
| InChIKey | FPCFDVDVODRRMH-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |