C13H9ClFN3O — CID 103553641
4-(4,6-diamino-3-chloro-2-fluorophenoxy)benzonitrile (PubChem CID 103553641) has the molecular formula C13H9ClFN3O and a molecular weight of 277.69 g/mol. Its IUPAC name is 4-(4,6-diamino-3-chloro-2-fluorophenoxy)benzonitrile.
| Compound Name | 4-(4,6-diamino-3-chloro-2-fluorophenoxy)benzonitrile |
|---|---|
| PubChem CID | 103553641 |
| Molecular Formula | C13H9ClFN3O |
| Molecular Weight | 277.69 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-(4,6-diamino-3-chloro-2-fluorophenoxy)benzonitrile |
| SMILES | N#Cc1ccc(Oc2c(N)cc(N)c(Cl)c2F)cc1 |
| InChI | InChI=1S/C13H9ClFN3O/c14-11-9(17)5-10(18)13(12(11)15)19-8-3-1-7(6-16)2-4-8/h1-5H,17-18H2 |
| InChIKey | YNWVAXFKQAKGNK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|