C24H8F6N2O2 — CID 175999058
4-[6-(4-cyanophenoxy)-1,3,4,5,7,8-hexafluoronaphthalen-2-yl]oxybenzonitrile (PubChem CID 175999058) has the molecular formula C24H8F6N2O2 and a molecular weight of 470.33 g/mol. Its IUPAC name is 4-[6-(4-cyanophenoxy)-1,3,4,5,7,8-hexafluoronaphthalen-2-yl]oxybenzonitrile.
| Compound Name | 4-[6-(4-cyanophenoxy)-1,3,4,5,7,8-hexafluoronaphthalen-2-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 175999058 |
| Molecular Formula | C24H8F6N2O2 |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 4-[6-(4-cyanophenoxy)-1,3,4,5,7,8-hexafluoronaphthalen-2-yl]oxybenzonitrile |
| SMILES | N#Cc1ccc(Oc2c(F)c(F)c3c(F)c(Oc4ccc(C#N)cc4)c(F)c(F)c3c2F)cc1 |
| InChI | InChI=1S/C24H8F6N2O2/c25-17-16-15(19(27)23(21(17)29)33-13-5-1-11(9-31)2-6-13)18(26)22(30)24(20(16)28)34-14-7-3-12(10-32)4-8-14/h1-8H |
| InChIKey | RMNMSNSNFCBGDH-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|