C11H20F3NO — CID 103559718
6,6,6-trifluoro-1-(1-methoxycyclobutyl)hexan-2-amine (PubChem CID 103559718) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-(1-methoxycyclobutyl)hexan-2-amine.
| Compound Name | 6,6,6-trifluoro-1-(1-methoxycyclobutyl)hexan-2-amine |
|---|---|
| PubChem CID | 103559718 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 6,6,6-trifluoro-1-(1-methoxycyclobutyl)hexan-2-amine |
| SMILES | COC1(CC(N)CCCC(F)(F)F)CCC1 |
| InChI | InChI=1S/C11H20F3NO/c1-16-10(5-3-6-10)8-9(15)4-2-7-11(12,13)14/h9H,2-8,15H2,1H3 |
| InChIKey | KGURHCSICGHWOH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |