C12H10N2O6 — CID 10356179
methyl 2-methyl-6-nitro-1,3-dioxo-4H-isoquinoline-4-carboxylate (PubChem CID 10356179) has the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. Its IUPAC name is methyl 2-methyl-6-nitro-1,3-dioxo-4H-isoquinoline-4-carboxylate.
| Compound Name | methyl 2-methyl-6-nitro-1,3-dioxo-4H-isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 10356179 |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | methyl 2-methyl-6-nitro-1,3-dioxo-4H-isoquinoline-4-carboxylate |
| SMILES | COC(=O)C1C(=O)N(C)C(=O)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C12H10N2O6/c1-13-10(15)7-4-3-6(14(18)19)5-8(7)9(11(13)16)12(17)20-2/h3-5,9H,1-2H3 |
| InChIKey | XPFXNXBAKIQCBU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|