C20H22N2O11 — CID 134850773
diethyl 2-(4-ethoxycarbonyl-2-methoxy-6-nitro-1,3-dioxoisoquinolin-4-yl)propanedioate (PubChem CID 134850773) has the molecular formula C20H22N2O11 and a molecular weight of 466.40 g/mol. Its IUPAC name is diethyl 2-(4-ethoxycarbonyl-2-methoxy-6-nitro-1,3-dioxoisoquinolin-4-yl)propanedioate.
| Compound Name | diethyl 2-(4-ethoxycarbonyl-2-methoxy-6-nitro-1,3-dioxoisoquinolin-4-yl)propanedioate |
|---|---|
| PubChem CID | 134850773 |
| Molecular Formula | C20H22N2O11 |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | diethyl 2-(4-ethoxycarbonyl-2-methoxy-6-nitro-1,3-dioxoisoquinolin-4-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1(C(=O)OCC)C(=O)N(OC)C(=O)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H22N2O11/c1-5-31-16(24)14(17(25)32-6-2)20(19(27)33-7-3)13-10-11(22(28)29)8-9-12(13)15(23)21(30-4)18(20)26/h8-10,14H,5-7H2,1-4H3 |
| InChIKey | WBPKAISCHMCOLQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 168.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|