C19H30O2 — CID 10356900
2-[(7E)-8,12-dimethyltrideca-7,11-dien-3-ynyl]-2-methyl-1,3-dioxolane (PubChem CID 10356900) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-[(7E)-8,12-dimethyltrideca-7,11-dien-3-ynyl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-[(7E)-8,12-dimethyltrideca-7,11-dien-3-ynyl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10356900 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-[(7E)-8,12-dimethyltrideca-7,11-dien-3-ynyl]-2-methyl-1,3-dioxolane |
| SMILES | CC(C)=CCC/C(C)=C/CCC#CCCC1(C)OCCO1 |
| InChI | InChI=1S/C19H30O2/c1-17(2)11-10-13-18(3)12-8-6-5-7-9-14-19(4)20-15-16-21-19/h11-12H,6,8-10,13-16H2,1-4H3/b18-12+ |
| InChIKey | AYUSLRYUVSGPDF-LDADJPATSA-N |
| XLogP | 5.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|