C12H18O2 — CID 10845500
2-[(Z)-3-methyloct-3-en-7-ynyl]-1,3-dioxolane (PubChem CID 10845500) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-[(Z)-3-methyloct-3-en-7-ynyl]-1,3-dioxolane.
| Compound Name | 2-[(Z)-3-methyloct-3-en-7-ynyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10845500 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-[(Z)-3-methyloct-3-en-7-ynyl]-1,3-dioxolane |
| SMILES | C#CCC/C=C(/C)CCC1OCCO1 |
| InChI | InChI=1S/C12H18O2/c1-3-4-5-6-11(2)7-8-12-13-9-10-14-12/h1,6,12H,4-5,7-10H2,2H3/b11-6- |
| InChIKey | CRIYRMNJMZPSJX-WDZFZDKYSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|