C15H24O6 — CID 10357439
(1S,2S,6S,7R,9R)-7-(1-ethoxyethoxy)-4,4-dimethyl-3,5,8-trioxatricyclo[7.3.0.02,6]dodecan-12-one (PubChem CID 10357439) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is (1S,2S,6S,7R,9R)-7-(1-ethoxyethoxy)-4,4-dimethyl-3,5,8-trioxatricyclo[7.3.0.02,6]dodecan-12-one.
| Compound Name | (1S,2S,6S,7R,9R)-7-(1-ethoxyethoxy)-4,4-dimethyl-3,5,8-trioxatricyclo[7.3.0.02,6]dodecan-12-one |
|---|---|
| PubChem CID | 10357439 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (1S,2S,6S,7R,9R)-7-(1-ethoxyethoxy)-4,4-dimethyl-3,5,8-trioxatricyclo[7.3.0.02,6]dodecan-12-one |
| SMILES | CCOC(C)O[C@H]1O[C@@H]2CCC(=O)[C@@H]2[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H24O6/c1-5-17-8(2)18-14-13-12(20-15(3,4)21-13)11-9(16)6-7-10(11)19-14/h8,10-14H,5-7H2,1-4H3/t8?,10-,11+,12+,13+,14+/m1/s1 |
| InChIKey | URSYMZSYFINBHB-FWUGFNRVSA-N |
| XLogP | 1.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|