C16H24O6 — CID 162409400
3-[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]cyclopentan-1-one (PubChem CID 162409400) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]cyclopentan-1-one.
| Compound Name | 3-[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 162409400 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]cyclopentan-1-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(C4CCC(=O)C4)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C16H24O6/c1-14(2)19-11-8-18-16(9-5-6-10(17)7-9)13(12(11)20-14)21-15(3,4)22-16/h9,11-13H,5-8H2,1-4H3/t9?,11-,12-,13+,16+/m1/s1 |
| InChIKey | CMOLILOOSOPTMP-SHJPUUIPSA-N |
| XLogP | 1.75 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |