C24H42O7 — CID 23629491
(2R,4S)-2-(2-ethyl-1,3-dioxolan-2-yl)-4-[(4S,5S,6R)-6-[(1S)-1-(2-ethyl-1,3-dioxolan-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-3-one (PubChem CID 23629491) has the molecular formula C24H42O7 and a molecular weight of 442.59 g/mol. Its IUPAC name is (2R,4S)-2-(2-ethyl-1,3-dioxolan-2-yl)-4-[(4S,5S,6R)-6-[(1S)-1-(2-ethyl-1,3-dioxolan-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-3-one.
| Compound Name | (2R,4S)-2-(2-ethyl-1,3-dioxolan-2-yl)-4-[(4S,5S,6R)-6-[(1S)-1-(2-ethyl-1,3-dioxolan-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-3-one |
|---|---|
| PubChem CID | 23629491 |
| Molecular Formula | C24H42O7 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (2R,4S)-2-(2-ethyl-1,3-dioxolan-2-yl)-4-[(4S,5S,6R)-6-[(1S)-1-(2-ethyl-1,3-dioxolan-2-yl)ethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]pentan-3-one |
| SMILES | CCC1([C@H](C)C(=O)[C@@H](C)[C@H]2OC(C)(C)O[C@@H]([C@H](C)C3(CC)OCCO3)[C@H]2C)OCCO1 |
| InChI | InChI=1S/C24H42O7/c1-9-23(26-11-12-27-23)17(5)19(25)15(3)20-16(4)21(31-22(7,8)30-20)18(6)24(10-2)28-13-14-29-24/h15-18,20-21H,9-14H2,1-8H3/t15-,16+,17-,18+,20-,21-/m1/s1 |
| InChIKey | CNCMFQMFDKJPNG-GOGWGUGKSA-N |
| XLogP | 3.93 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |