C26H42O7 — CID 154731525
methyl 2-[(5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(2S,3S,5R)-3,5-dimethyl-6-oxooxan-2-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-yl]acetate (PubChem CID 154731525) has the molecular formula C26H42O7 and a molecular weight of 466.62 g/mol. Its IUPAC name is methyl 2-[(5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(2S,3S,5R)-3,5-dimethyl-6-oxooxan-2-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-yl]acetate.
| Compound Name | methyl 2-[(5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(2S,3S,5R)-3,5-dimethyl-6-oxooxan-2-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-yl]acetate |
|---|---|
| PubChem CID | 154731525 |
| Molecular Formula | C26H42O7 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | methyl 2-[(5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(2S,3S,5R)-3,5-dimethyl-6-oxooxan-2-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-yl]acetate |
| SMILES | CC[C@@]1([C@@H]2O[C@@H]([C@H]3OC(=O)[C@H](C)C[C@@H]3C)C[C@@H]2C)CC[C@H]([C@]2(C)CCC(CC(=O)OC)O2)O1 |
| InChI | InChI=1S/C26H42O7/c1-7-26(11-9-20(33-26)25(5)10-8-18(32-25)14-21(27)29-6)23-16(3)13-19(30-23)22-15(2)12-17(4)24(28)31-22/h15-20,22-23H,7-14H2,1-6H3/t15-,16-,17+,18?,19+,20+,22-,23+,25-,26-/m0/s1 |
| InChIKey | FNTCBPXQLWXJKH-ORILXDHRSA-N |
| XLogP | 4.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |