C23H36O6 — CID 14163850
(3R,5S,6S)-6-[(2R,4S,5R)-5-[(2S,5R)-2-ethyl-5-[(2S)-2-methyl-5-oxooxolan-2-yl]oxolan-2-yl]-4-methyloxolan-2-yl]-3,5-dimethyloxan-2-one (PubChem CID 14163850) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is (3R,5S,6S)-6-[(2R,4S,5R)-5-[(2S,5R)-2-ethyl-5-[(2S)-2-methyl-5-oxooxolan-2-yl]oxolan-2-yl]-4-methyloxolan-2-yl]-3,5-dimethyloxan-2-one.
| Compound Name | (3R,5S,6S)-6-[(2R,4S,5R)-5-[(2S,5R)-2-ethyl-5-[(2S)-2-methyl-5-oxooxolan-2-yl]oxolan-2-yl]-4-methyloxolan-2-yl]-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 14163850 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (3R,5S,6S)-6-[(2R,4S,5R)-5-[(2S,5R)-2-ethyl-5-[(2S)-2-methyl-5-oxooxolan-2-yl]oxolan-2-yl]-4-methyloxolan-2-yl]-3,5-dimethyloxan-2-one |
| SMILES | CC[C@@]1([C@@H]2O[C@@H]([C@H]3OC(=O)[C@H](C)C[C@@H]3C)C[C@@H]2C)CC[C@H]([C@]2(C)CCC(=O)O2)O1 |
| InChI | InChI=1S/C23H36O6/c1-6-23(10-7-17(28-23)22(5)9-8-18(24)29-22)20-14(3)12-16(26-20)19-13(2)11-15(4)21(25)27-19/h13-17,19-20H,6-12H2,1-5H3/t13-,14-,15+,16+,17+,19-,20+,22-,23-/m0/s1 |
| InChIKey | JPFAFFJNFKCSJV-ALMWVUNISA-N |
| XLogP | 3.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |