C25H40O7 — CID 14163852
(5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(7S,8S,10R)-8,10-dimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-one (PubChem CID 14163852) has the molecular formula C25H40O7 and a molecular weight of 452.59 g/mol. Its IUPAC name is (5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(7S,8S,10R)-8,10-dimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-one.
| Compound Name | (5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(7S,8S,10R)-8,10-dimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 14163852 |
| Molecular Formula | C25H40O7 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | (5S)-5-[(2R,5S)-5-[(2R,3S,5R)-5-[(7S,8S,10R)-8,10-dimethyl-1,4,6-trioxaspiro[4.5]decan-7-yl]-3-methyloxolan-2-yl]-5-ethyloxolan-2-yl]-5-methyloxolan-2-one |
| SMILES | CC[C@@]1([C@@H]2O[C@@H]([C@H]3OC4(OCCO4)[C@H](C)C[C@@H]3C)C[C@@H]2C)CC[C@H]([C@]2(C)CCC(=O)O2)O1 |
| InChI | InChI=1S/C25H40O7/c1-6-24(10-7-19(30-24)23(5)9-8-20(26)31-23)22-16(3)14-18(29-22)21-15(2)13-17(4)25(32-21)27-11-12-28-25/h15-19,21-22H,6-14H2,1-5H3/t15-,16-,17+,18+,19+,21-,22+,23-,24-/m0/s1 |
| InChIKey | DHICKFAFVGSVRY-YLNMCSLNSA-N |
| XLogP | 3.97 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |