C15H16N4 — CID 103577412
2-(3-amino-4-methylpyrrolidin-1-yl)quinoline-3-carbonitrile (PubChem CID 103577412) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-(3-amino-4-methylpyrrolidin-1-yl)quinoline-3-carbonitrile.
| Compound Name | 2-(3-amino-4-methylpyrrolidin-1-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 103577412 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(3-amino-4-methylpyrrolidin-1-yl)quinoline-3-carbonitrile |
| SMILES | CC1CN(c2nc3ccccc3cc2C#N)CC1N |
| InChI | InChI=1S/C15H16N4/c1-10-8-19(9-13(10)17)15-12(7-16)6-11-4-2-3-5-14(11)18-15/h2-6,10,13H,8-9,17H2,1H3 |
| InChIKey | NUFDKSILZNOPHR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |