C17H20N4 — CID 81452578
2-(4-amino-3-ethylpiperidin-1-yl)quinoline-3-carbonitrile (PubChem CID 81452578) has the molecular formula C17H20N4 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(4-amino-3-ethylpiperidin-1-yl)quinoline-3-carbonitrile.
| Compound Name | 2-(4-amino-3-ethylpiperidin-1-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 81452578 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-(4-amino-3-ethylpiperidin-1-yl)quinoline-3-carbonitrile |
| SMILES | CCC1CN(c2nc3ccccc3cc2C#N)CCC1N |
| InChI | InChI=1S/C17H20N4/c1-2-12-11-21(8-7-15(12)19)17-14(10-18)9-13-5-3-4-6-16(13)20-17/h3-6,9,12,15H,2,7-8,11,19H2,1H3 |
| InChIKey | JIHXXRPHCXTISK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |