C17H18N4O — CID 166323522
N-[(3S)-1-(3-cyanoquinolin-2-yl)pyrrolidin-3-yl]propanamide (PubChem CID 166323522) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is N-[(3S)-1-(3-cyanoquinolin-2-yl)pyrrolidin-3-yl]propanamide.
| Compound Name | N-[(3S)-1-(3-cyanoquinolin-2-yl)pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 166323522 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[(3S)-1-(3-cyanoquinolin-2-yl)pyrrolidin-3-yl]propanamide |
| SMILES | CCC(=O)N[C@H]1CCN(c2nc3ccccc3cc2C#N)C1 |
| InChI | InChI=1S/C17H18N4O/c1-2-16(22)19-14-7-8-21(11-14)17-13(10-18)9-12-5-3-4-6-15(12)20-17/h3-6,9,14H,2,7-8,11H2,1H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | MNQJHQXJUPSGMA-AWEZNQCLSA-N |
| XLogP | 2.21 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |