C12H23NO3S — CID 103578357
1-(1,1-dioxo-1,4-thiazepan-4-yl)-4,4-dimethylpentan-3-one (PubChem CID 103578357) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazepan-4-yl)-4,4-dimethylpentan-3-one.
| Compound Name | 1-(1,1-dioxo-1,4-thiazepan-4-yl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 103578357 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazepan-4-yl)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)CCN1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H23NO3S/c1-12(2,3)11(14)5-7-13-6-4-9-17(15,16)10-8-13/h4-10H2,1-3H3 |
| InChIKey | CLLDFTWMXYPMRI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |