C13H28N2O2S — CID 114083387
6-(1,1-dioxo-1,4-thiazepan-4-yl)-2,2-dimethylhexan-1-amine (PubChem CID 114083387) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 6-(1,1-dioxo-1,4-thiazepan-4-yl)-2,2-dimethylhexan-1-amine.
| Compound Name | 6-(1,1-dioxo-1,4-thiazepan-4-yl)-2,2-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 114083387 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 6-(1,1-dioxo-1,4-thiazepan-4-yl)-2,2-dimethylhexan-1-amine |
| SMILES | CC(C)(CN)CCCCN1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H28N2O2S/c1-13(2,12-14)6-3-4-7-15-8-5-10-18(16,17)11-9-15/h3-12,14H2,1-2H3 |
| InChIKey | RJFBBCRUGCBRHE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|