C12H25N3O3S — CID 106710744
6-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106710744) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106710744 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 6-(1,1-dioxo-1,4-thiazinan-4-yl)-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CC(C)(CCCCN1CCS(=O)(=O)CC1)C(N)=NO |
| InChI | InChI=1S/C12H25N3O3S/c1-12(2,11(13)14-16)5-3-4-6-15-7-9-19(17,18)10-8-15/h16H,3-10H2,1-2H3,(H2,13,14) |
| InChIKey | JASYOLOTOMMLGC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|