C11H21F2NO — CID 103578519
N-[2-(2,2-difluoroethoxy)ethyl]-3-propan-2-ylcyclobutan-1-amine (PubChem CID 103578519) has the molecular formula C11H21F2NO and a molecular weight of 221.29 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-3-propan-2-ylcyclobutan-1-amine.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-propan-2-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 103578519 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-3-propan-2-ylcyclobutan-1-amine |
| SMILES | CC(C)C1CC(NCCOCC(F)F)C1 |
| InChI | InChI=1S/C11H21F2NO/c1-8(2)9-5-10(6-9)14-3-4-15-7-11(12)13/h8-11,14H,3-7H2,1-2H3 |
| InChIKey | VTNHVWFUOFSGJA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|