C14H15NO2 — CID 103579233
N-pent-1-yn-3-yl-2,3-dihydro-1-benzofuran-3-carboxamide (PubChem CID 103579233) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-pent-1-yn-3-yl-2,3-dihydro-1-benzofuran-3-carboxamide.
| Compound Name | N-pent-1-yn-3-yl-2,3-dihydro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 103579233 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-pent-1-yn-3-yl-2,3-dihydro-1-benzofuran-3-carboxamide |
| SMILES | C#CC(CC)NC(=O)C1COc2ccccc21 |
| InChI | InChI=1S/C14H15NO2/c1-3-10(4-2)15-14(16)12-9-17-13-8-6-5-7-11(12)13/h1,5-8,10,12H,4,9H2,2H3,(H,15,16) |
| InChIKey | SPBISNMVIUCKEM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|