C16H23NOS2 — CID 10357995
(E)-1-(2-methyl-1,3-dithiolan-2-yl)-N-phenylmethoxypentan-3-imine (PubChem CID 10357995) has the molecular formula C16H23NOS2 and a molecular weight of 309.50 g/mol. Its IUPAC name is (E)-1-(2-methyl-1,3-dithiolan-2-yl)-N-phenylmethoxypentan-3-imine.
| Compound Name | (E)-1-(2-methyl-1,3-dithiolan-2-yl)-N-phenylmethoxypentan-3-imine |
|---|---|
| PubChem CID | 10357995 |
| Molecular Formula | C16H23NOS2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (E)-1-(2-methyl-1,3-dithiolan-2-yl)-N-phenylmethoxypentan-3-imine |
| SMILES | CC/C(CCC1(C)SCCS1)=N\OCc1ccccc1 |
| InChI | InChI=1S/C16H23NOS2/c1-3-15(9-10-16(2)19-11-12-20-16)17-18-13-14-7-5-4-6-8-14/h4-8H,3,9-13H2,1-2H3/b17-15+ |
| InChIKey | IJJMVCAUOVVLSR-BMRADRMJSA-N |
| XLogP | 4.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|