C13H12BrFN2O2S — CID 103580466
N-(4-bromo-3,5-dimethylphenyl)-5-fluoropyridine-3-sulfonamide (PubChem CID 103580466) has the molecular formula C13H12BrFN2O2S and a molecular weight of 359.22 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)-5-fluoropyridine-3-sulfonamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)-5-fluoropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103580466 |
| Molecular Formula | C13H12BrFN2O2S |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)-5-fluoropyridine-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cncc(F)c2)cc(C)c1Br |
| InChI | InChI=1S/C13H12BrFN2O2S/c1-8-3-11(4-9(2)13(8)14)17-20(18,19)12-5-10(15)6-16-7-12/h3-7,17H,1-2H3 |
| InChIKey | PIXKGPQCXCDMIG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |