C15H15BrClN3 — CID 103582921
N-[(2-aminophenyl)methyl]-5-bromo-3-chloro-N-cyclopropylpyridin-2-amine (PubChem CID 103582921) has the molecular formula C15H15BrClN3 and a molecular weight of 352.66 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-5-bromo-3-chloro-N-cyclopropylpyridin-2-amine.
| Compound Name | N-[(2-aminophenyl)methyl]-5-bromo-3-chloro-N-cyclopropylpyridin-2-amine |
|---|---|
| PubChem CID | 103582921 |
| Molecular Formula | C15H15BrClN3 |
| Molecular Weight | 352.66 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-5-bromo-3-chloro-N-cyclopropylpyridin-2-amine |
| SMILES | Nc1ccccc1CN(c1ncc(Br)cc1Cl)C1CC1 |
| InChI | InChI=1S/C15H15BrClN3/c16-11-7-13(17)15(19-8-11)20(12-5-6-12)9-10-3-1-2-4-14(10)18/h1-4,7-8,12H,5-6,9,18H2 |
| InChIKey | QESWWSJCXQSUPK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|