C12H14N4S — CID 65276126
N-[(2-aminophenyl)methyl]-N-cyclopropyl-1,2,4-thiadiazol-5-amine (PubChem CID 65276126) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-N-cyclopropyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[(2-aminophenyl)methyl]-N-cyclopropyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65276126 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-N-cyclopropyl-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1ccccc1CN(c1ncns1)C1CC1 |
| InChI | InChI=1S/C12H14N4S/c13-11-4-2-1-3-9(11)7-16(10-5-6-10)12-14-8-15-17-12/h1-4,8,10H,5-7,13H2 |
| InChIKey | DHHDOFILGOFTPV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|