C11H15F2NO — CID 103585594
3-(2,5-difluoro-4-methylanilino)butan-2-ol (PubChem CID 103585594) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-methylanilino)butan-2-ol.
| Compound Name | 3-(2,5-difluoro-4-methylanilino)butan-2-ol |
|---|---|
| PubChem CID | 103585594 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-(2,5-difluoro-4-methylanilino)butan-2-ol |
| SMILES | Cc1cc(F)c(NC(C)C(C)O)cc1F |
| InChI | InChI=1S/C11H15F2NO/c1-6-4-10(13)11(5-9(6)12)14-7(2)8(3)15/h4-5,7-8,14-15H,1-3H3 |
| InChIKey | QHQSUNDUJZKNEQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |