C11H11F2N — CID 103585508
N-but-3-yn-2-yl-2,5-difluoro-4-methylaniline (PubChem CID 103585508) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is N-but-3-yn-2-yl-2,5-difluoro-4-methylaniline.
| Compound Name | N-but-3-yn-2-yl-2,5-difluoro-4-methylaniline |
|---|---|
| PubChem CID | 103585508 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-but-3-yn-2-yl-2,5-difluoro-4-methylaniline |
| SMILES | C#CC(C)Nc1cc(F)c(C)cc1F |
| InChI | InChI=1S/C11H11F2N/c1-4-8(3)14-11-6-9(12)7(2)5-10(11)13/h1,5-6,8,14H,2-3H3 |
| InChIKey | UAVDRALRKCVDIV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|